C24H52N4O7P+ — CID 163599377
2-[2-[5-[[2-amino-2-(methylamino)acetyl]amino]-2-ethyl-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 163599377) has the molecular formula C24H52N4O7P+ and a molecular weight of 539.68 g/mol. Its IUPAC name is 2-[2-[5-[[2-amino-2-(methylamino)acetyl]amino]-2-ethyl-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[5-[[2-amino-2-(methylamino)acetyl]amino]-2-ethyl-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 163599377 |
| Molecular Formula | C24H52N4O7P+ |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | 2-[2-[5-[[2-amino-2-(methylamino)acetyl]amino]-2-ethyl-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC(C)(C(=O)OCCOP(=O)(O)OCC[N+](C)(C)C)C(C)(C)CC(NC(=O)C(N)NC)C(C)(C)C |
| InChI | InChI=1S/C24H51N4O7P/c1-12-24(7,21(30)33-15-16-35-36(31,32)34-14-13-28(9,10)11)23(5,6)17-18(22(2,3)4)27-20(29)19(25)26-8/h18-19,26H,12-17,25H2,1-11H3,(H-,27,29,31,32)/p+1 |
| InChIKey | GWHASOKVOWFVAN-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|