C20H37NO8P+ — CID 90689420
2-[[(2R)-2,3-di(hex-3-enoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 90689420) has the molecular formula C20H37NO8P+ and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[[(2R)-2,3-di(hex-3-enoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-di(hex-3-enoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 90689420 |
| Molecular Formula | C20H37NO8P+ |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[[(2R)-2,3-di(hex-3-enoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC=CCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC=CCC |
| InChI | InChI=1S/C20H36NO8P/c1-6-8-10-12-19(22)26-16-18(29-20(23)13-11-9-7-2)17-28-30(24,25)27-15-14-21(3,4)5/h8-11,18H,6-7,12-17H2,1-5H3/p+1/t18-/m1/s1 |
| InChIKey | WLKSBJHNVTYRNU-GOSISDBHSA-O |
| XLogP | 2.99 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|