C30H53NO8P+ — CID 154573468
2-[[(2R)-2,3-di(undeca-3,6-dienoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 154573468) has the molecular formula C30H53NO8P+ and a molecular weight of 586.73 g/mol. Its IUPAC name is 2-[[(2R)-2,3-di(undeca-3,6-dienoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-di(undeca-3,6-dienoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 154573468 |
| Molecular Formula | C30H53NO8P+ |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 2-[[(2R)-2,3-di(undeca-3,6-dienoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC=CCC=CCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC=CCC=CCCCC |
| InChI | InChI=1S/C30H52NO8P/c1-6-8-10-12-14-16-18-20-22-29(32)36-26-28(27-38-40(34,35)37-25-24-31(3,4)5)39-30(33)23-21-19-17-15-13-11-9-7-2/h12-15,18-21,28H,6-11,16-17,22-27H2,1-5H3/p+1/t28-/m1/s1 |
| InChIKey | CXKQABCABFBHLD-MUUNZHRXSA-O |
| XLogP | 6.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|