C40H75NO8P+ — CID 138251106
2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138251106) has the molecular formula C40H75NO8P+ and a molecular weight of 729.01 g/mol. Its IUPAC name is 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138251106 |
| Molecular Formula | C40H75NO8P+ |
| Molecular Weight | 729.01 g/mol |
| Exact Mass | 728.52 |
| IUPAC Name | 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C40H74NO8P/c1-6-8-10-12-14-16-18-20-21-23-25-27-29-31-33-40(43)49-38(37-48-50(44,45)47-35-34-41(3,4)5)36-46-39(42)32-30-28-26-24-22-19-17-15-13-11-9-7-2/h12,14-15,17-18,20,38H,6-11,13,16,19,21-37H2,1-5H3/p+1/b14-12-,17-15-,20-18- |
| InChIKey | RECGYOHQDUXTDP-NHEYHVDRSA-O |
| XLogP | 10.57 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.01 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|