C32H61NO8P+ — CID 138147998
2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138147998) has the molecular formula C32H61NO8P+ and a molecular weight of 618.81 g/mol. Its IUPAC name is 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138147998 |
| Molecular Formula | C32H61NO8P+ |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.41 |
| IUPAC Name | 2-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C32H60NO8P/c1-6-8-10-12-13-14-15-16-17-18-19-20-21-23-25-32(35)41-30(28-38-31(34)24-22-11-9-7-2)29-40-42(36,37)39-27-26-33(3,4)5/h12-13,15-16,30H,6-11,14,17-29H2,1-5H3/p+1/b13-12-,16-15- |
| InChIKey | DVTOBJXRXJUNIV-QGLGPCELSA-O |
| XLogP | 7.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|