C42H77NO8P+ — CID 134729675
2-[[(2R)-2,3-bis[[(9E,12E)-heptadeca-9,12-dienoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134729675) has the molecular formula C42H77NO8P+ and a molecular weight of 755.05 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis[[(9E,12E)-heptadeca-9,12-dienoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis[[(9E,12E)-heptadeca-9,12-dienoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134729675 |
| Molecular Formula | C42H77NO8P+ |
| Molecular Weight | 755.05 g/mol |
| Exact Mass | 754.54 |
| IUPAC Name | 2-[[(2R)-2,3-bis[[(9E,12E)-heptadeca-9,12-dienoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/C/C=C/CCCC |
| InChI | InChI=1S/C42H76NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-41(44)48-38-40(39-50-52(46,47)49-37-36-43(3,4)5)51-42(45)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h12-15,18-21,40H,6-11,16-17,22-39H2,1-5H3/p+1/b14-12+,15-13+,20-18+,21-19+/t40-/m1/s1 |
| InChIKey | FJCUMLVANOXIFV-FIUWVDSASA-O |
| XLogP | 11.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.05 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|