C17H33NO7P+ — CID 177116250
2-[hydroxy-[2-hydroxy-3-[(3Z,6Z)-nona-3,6-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 177116250) has the molecular formula C17H33NO7P+ and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[hydroxy-[2-hydroxy-3-[(3Z,6Z)-nona-3,6-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-hydroxy-3-[(3Z,6Z)-nona-3,6-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 177116250 |
| Molecular Formula | C17H33NO7P+ |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[hydroxy-[2-hydroxy-3-[(3Z,6Z)-nona-3,6-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\CC(=O)OCC(O)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C17H32NO7P/c1-5-6-7-8-9-10-11-17(20)23-14-16(19)15-25-26(21,22)24-13-12-18(2,3)4/h6-7,9-10,16,19H,5,8,11-15H2,1-4H3/p+1/b7-6-,10-9- |
| InChIKey | YEKFUVZQDMRFFR-HZJYTTRNSA-O |
| XLogP | 2.03 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|