C24H38NO9P — CID 138152997
2-amino-3-[hydroxy-[2-hydroxy-3-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 138152997) has the molecular formula C24H38NO9P and a molecular weight of 515.54 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[2-hydroxy-3-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[2-hydroxy-3-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138152997 |
| Molecular Formula | C24H38NO9P |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-amino-3-[hydroxy-[2-hydroxy-3-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OCC(O)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C24H38NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)32-18-21(26)19-33-35(30,31)34-20-22(25)24(28)29/h3-4,6-7,9-10,12-13,15-16,21-22,26H,2,5,8,11,14,17-20,25H2,1H3,(H,28,29)(H,30,31)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | FLADCKJJVUUJTB-JLNKQSITSA-N |
| XLogP | 3.58 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|