C22H40NO9P — CID 138190403
2-amino-3-[[3-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138190403) has the molecular formula C22H40NO9P and a molecular weight of 493.53 g/mol. Its IUPAC name is 2-amino-3-[[3-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138190403 |
| Molecular Formula | C22H40NO9P |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-amino-3-[[3-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C22H40NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(25)30-16-19(24)17-31-33(28,29)32-18-20(23)22(26)27/h4-5,7-8,19-20,24H,2-3,6,9-18,23H2,1H3,(H,26,27)(H,28,29)/b5-4-,8-7- |
| InChIKey | JXLBHOJERKLBKR-UTOQUPLUSA-N |
| XLogP | 3.47 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|