C27H52NO9P — CID 138149718
2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138149718) has the molecular formula C27H52NO9P and a molecular weight of 565.69 g/mol. Its IUPAC name is 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138149718 |
| Molecular Formula | C27H52NO9P |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C27H52NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(30)35-21-24(29)22-36-38(33,34)37-23-25(28)27(31)32/h10-11,24-25,29H,2-9,12-23,28H2,1H3,(H,31,32)(H,33,34)/b11-10- |
| InChIKey | FBEMJMCWJCKAAH-KHPPLWFESA-N |
| XLogP | 5.64 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|