C37H64NO10P — CID 134741398
(2S)-2-amino-3-[hydroxy-[(2S)-2-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134741398) has the molecular formula C37H64NO10P and a molecular weight of 713.89 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2S)-2-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2S)-2-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134741398 |
| Molecular Formula | C37H64NO10P |
| Molecular Weight | 713.89 g/mol |
| Exact Mass | 713.43 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2S)-2-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)O[C@@H](COC(=O)CCCCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C37H64NO10P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-29-36(40)48-33(31-46-49(43,44)47-32-34(38)37(41)42)30-45-35(39)28-26-24-22-12-10-8-6-4-2/h7,9,13-14,16-17,19-20,33-34H,3-6,8,10-12,15,18,21-32,38H2,1-2H3,(H,41,42)(H,43,44)/b9-7+,14-13+,17-16+,20-19+/t33-,34-/m0/s1 |
| InChIKey | JLNBRFZNDYBZEE-FDUTUKQCSA-N |
| XLogP | 8.66 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.89 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|