C33H60NO10P — CID 138267249
2-amino-3-[[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138267249) has the molecular formula C33H60NO10P and a molecular weight of 661.81 g/mol. Its IUPAC name is 2-amino-3-[[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138267249 |
| Molecular Formula | C33H60NO10P |
| Molecular Weight | 661.81 g/mol |
| Exact Mass | 661.40 |
| IUPAC Name | 2-amino-3-[[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C33H60NO10P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-32(36)44-29(27-42-45(39,40)43-28-30(34)33(37)38)26-41-31(35)24-22-20-18-12-10-8-6-4-2/h7,9,13-14,29-30H,3-6,8,10-12,15-28,34H2,1-2H3,(H,37,38)(H,39,40)/b9-7-,14-13- |
| InChIKey | TVGOCKZSNVBQHW-QIDSOVCESA-N |
| XLogP | 7.55 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.81 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|