C17H35IN2O7P+ — CID 159900133
[hydroxy-[2-[2-(iodomethyl)-2,4-dimethyl-5-oxo-5-(propan-2-ylamino)pentanoyl]oxyethoxy]phosphoryl]oxymethyl-trimethylazanium (PubChem CID 159900133) has the molecular formula C17H35IN2O7P+ and a molecular weight of 537.35 g/mol. Its IUPAC name is [hydroxy-[2-[2-(iodomethyl)-2,4-dimethyl-5-oxo-5-(propan-2-ylamino)pentanoyl]oxyethoxy]phosphoryl]oxymethyl-trimethylazanium.
| Compound Name | [hydroxy-[2-[2-(iodomethyl)-2,4-dimethyl-5-oxo-5-(propan-2-ylamino)pentanoyl]oxyethoxy]phosphoryl]oxymethyl-trimethylazanium |
|---|---|
| PubChem CID | 159900133 |
| Molecular Formula | C17H35IN2O7P+ |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | [hydroxy-[2-[2-(iodomethyl)-2,4-dimethyl-5-oxo-5-(propan-2-ylamino)pentanoyl]oxyethoxy]phosphoryl]oxymethyl-trimethylazanium |
| SMILES | CC(C)NC(=O)C(C)CC(C)(CI)C(=O)OCCOP(=O)(O)OC[N+](C)(C)C |
| InChI | InChI=1S/C17H34IN2O7P/c1-13(2)19-15(21)14(3)10-17(4,11-18)16(22)25-8-9-26-28(23,24)27-12-20(5,6)7/h13-14H,8-12H2,1-7H3,(H-,19,21,23,24)/p+1 |
| InChIKey | HFRFAZVEOHIWAP-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|