C18H29IO10 — CID 59918247
bis(3-acetyloxy-2-hydroxypropyl) 2-(iodomethyl)-2,4-dimethylpentanedioate (PubChem CID 59918247) has the molecular formula C18H29IO10 and a molecular weight of 532.32 g/mol. Its IUPAC name is bis(3-acetyloxy-2-hydroxypropyl) 2-(iodomethyl)-2,4-dimethylpentanedioate.
| Compound Name | bis(3-acetyloxy-2-hydroxypropyl) 2-(iodomethyl)-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 59918247 |
| Molecular Formula | C18H29IO10 |
| Molecular Weight | 532.32 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | bis(3-acetyloxy-2-hydroxypropyl) 2-(iodomethyl)-2,4-dimethylpentanedioate |
| SMILES | CC(=O)OCC(O)COC(=O)C(C)CC(C)(CI)C(=O)OCC(O)COC(C)=O |
| InChI | InChI=1S/C18H29IO10/c1-11(16(24)28-8-14(22)6-26-12(2)20)5-18(4,10-19)17(25)29-9-15(23)7-27-13(3)21/h11,14-15,22-23H,5-10H2,1-4H3 |
| InChIKey | NYOHXSFMJCSFPR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|