C45H84O12 — CID 59765929
tetrakis(2-hydroxy-4,4-dimethylpentyl) 1,1,3,5,7-pentamethyloctane-1,3,5,7-tetracarboxylate (PubChem CID 59765929) has the molecular formula C45H84O12 and a molecular weight of 817.15 g/mol. Its IUPAC name is tetrakis(2-hydroxy-4,4-dimethylpentyl) 1,1,3,5,7-pentamethyloctane-1,3,5,7-tetracarboxylate.
| Compound Name | tetrakis(2-hydroxy-4,4-dimethylpentyl) 1,1,3,5,7-pentamethyloctane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 59765929 |
| Molecular Formula | C45H84O12 |
| Molecular Weight | 817.15 g/mol |
| Exact Mass | 816.60 |
| IUPAC Name | tetrakis(2-hydroxy-4,4-dimethylpentyl) 1,1,3,5,7-pentamethyloctane-1,3,5,7-tetracarboxylate |
| SMILES | CC(C)(C)CC(O)COC(=O)C(C)(C)CC(C)(CC(C)(CC(C)(C)C(=O)OCC(O)CC(C)(C)C)C(=O)OCC(O)CC(C)(C)C)C(=O)OCC(O)CC(C)(C)C |
| InChI | InChI=1S/C45H84O12/c1-38(2,3)19-30(46)23-54-34(50)42(13,14)27-44(17,36(52)56-25-32(48)21-40(7,8)9)29-45(18,37(53)57-26-33(49)22-41(10,11)12)28-43(15,16)35(51)55-24-31(47)20-39(4,5)6/h30-33,46-49H,19-29H2,1-18H3 |
| InChIKey | OSNNLUWRAVRMME-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.15 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|