C39H81N5O10 — CID 90888092
4-[3-[4,8-bis(dimethylamino)-6-[2-hydroxy-3-(methylamino)propoxy]carbonyl-2,2,4,6,8-pentamethyldecanoyl]oxy-2-hydroxypropoxy]carbonyl-2,2,4-trimethylhexanoic acid;methanamine (PubChem CID 90888092) has the molecular formula C39H81N5O10 and a molecular weight of 780.10 g/mol. Its IUPAC name is 4-[3-[4,8-bis(dimethylamino)-6-[2-hydroxy-3-(methylamino)propoxy]carbonyl-2,2,4,6,8-pentamethyldecanoyl]oxy-2-hydroxypropoxy]carbonyl-2,2,4-trimethylhexanoic acid;methanamine.
| Compound Name | 4-[3-[4,8-bis(dimethylamino)-6-[2-hydroxy-3-(methylamino)propoxy]carbonyl-2,2,4,6,8-pentamethyldecanoyl]oxy-2-hydroxypropoxy]carbonyl-2,2,4-trimethylhexanoic acid;methanamine |
|---|---|
| PubChem CID | 90888092 |
| Molecular Formula | C39H81N5O10 |
| Molecular Weight | 780.10 g/mol |
| Exact Mass | 779.60 |
| IUPAC Name | 4-[3-[4,8-bis(dimethylamino)-6-[2-hydroxy-3-(methylamino)propoxy]carbonyl-2,2,4,6,8-pentamethyldecanoyl]oxy-2-hydroxypropoxy]carbonyl-2,2,4-trimethylhexanoic acid;methanamine |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)C(=O)OCC(O)COC(=O)C(C)(C)CC(C)(CC(C)(CC(C)(CC)N(C)C)C(=O)OCC(O)CNC)N(C)C.CN.CN |
| InChI | InChI=1S/C37H71N3O10.2CH5N/c1-16-34(7,22-32(3,4)28(43)44)30(46)50-21-27(42)20-48-29(45)33(5,6)23-37(10,40(14)15)25-35(8,24-36(9,17-2)39(12)13)31(47)49-19-26(41)18-38-11;2*1-2/h26-27,38,41-42H,16-25H2,1-15H3,(H,43,44);2*2H2,1H3 |
| InChIKey | WGUBDRXJMSLAQC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 227.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|