C11H20O4 — CID 24749868
ethyl 4-(hydroxymethyl)-2,4-dimethyl-5-oxohexanoate (PubChem CID 24749868) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl 4-(hydroxymethyl)-2,4-dimethyl-5-oxohexanoate.
| Compound Name | ethyl 4-(hydroxymethyl)-2,4-dimethyl-5-oxohexanoate |
|---|---|
| PubChem CID | 24749868 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethyl 4-(hydroxymethyl)-2,4-dimethyl-5-oxohexanoate |
| SMILES | CCOC(=O)C(C)CC(C)(CO)C(C)=O |
| InChI | InChI=1S/C11H20O4/c1-5-15-10(14)8(2)6-11(4,7-12)9(3)13/h8,12H,5-7H2,1-4H3 |
| InChIKey | QINHLJCSLSZHMV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |