C10H19NO8S — CID 118227599
5-ethoxy-2-(hydroxysulfamoyloxymethyl)-2,4-dimethyl-5-oxopentanoic acid (PubChem CID 118227599) has the molecular formula C10H19NO8S and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-ethoxy-2-(hydroxysulfamoyloxymethyl)-2,4-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-ethoxy-2-(hydroxysulfamoyloxymethyl)-2,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118227599 |
| Molecular Formula | C10H19NO8S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-ethoxy-2-(hydroxysulfamoyloxymethyl)-2,4-dimethyl-5-oxopentanoic acid |
| SMILES | CCOC(=O)C(C)CC(C)(COS(=O)(=O)NO)C(=O)O |
| InChI | InChI=1S/C10H19NO8S/c1-4-18-8(12)7(2)5-10(3,9(13)14)6-19-20(16,17)11-15/h7,11,15H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | WXVSEDIKZZYJFF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|