C11H23NO4S — CID 79551597
ethyl 2-methyl-3-[(2-methyl-2-methylsulfonylpropyl)amino]propanoate (PubChem CID 79551597) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is ethyl 2-methyl-3-[(2-methyl-2-methylsulfonylpropyl)amino]propanoate.
| Compound Name | ethyl 2-methyl-3-[(2-methyl-2-methylsulfonylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 79551597 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 2-methyl-3-[(2-methyl-2-methylsulfonylpropyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)CNCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23NO4S/c1-6-16-10(13)9(2)7-12-8-11(3,4)17(5,14)15/h9,12H,6-8H2,1-5H3 |
| InChIKey | AWDPUBMFHKEVDW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |