C9H19NO4S — CID 15321974
ethyl (2S)-2-(methanesulfonamido)-3,3-dimethylbutanoate (PubChem CID 15321974) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is ethyl (2S)-2-(methanesulfonamido)-3,3-dimethylbutanoate.
| Compound Name | ethyl (2S)-2-(methanesulfonamido)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 15321974 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | ethyl (2S)-2-(methanesulfonamido)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)[C@@H](NS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C9H19NO4S/c1-6-14-8(11)7(9(2,3)4)10-15(5,12)13/h7,10H,6H2,1-5H3/t7-/m1/s1 |
| InChIKey | ITTGVKAASKTCBS-SSDOTTSWSA-N |
| XLogP | 0.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |