C14H30N2O2 — CID 61325588
ethyl 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanoate (PubChem CID 61325588) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is ethyl 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 61325588 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | ethyl 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(NCCN(CC)CC)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-7-16(8-2)11-10-15-12(14(4,5)6)13(17)18-9-3/h12,15H,7-11H2,1-6H3 |
| InChIKey | UQNXOCMJSBCNDL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |