C13H25NO4 — CID 91702788
propyl 3,3-dimethyl-2-(propoxycarbonylamino)butanoate (PubChem CID 91702788) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is propyl 3,3-dimethyl-2-(propoxycarbonylamino)butanoate.
| Compound Name | propyl 3,3-dimethyl-2-(propoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 91702788 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | propyl 3,3-dimethyl-2-(propoxycarbonylamino)butanoate |
| SMILES | CCCOC(=O)NC(C(=O)OCCC)C(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-6-8-17-11(15)10(13(3,4)5)14-12(16)18-9-7-2/h10H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | MZGFMEXUMXLFGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |