C20H39NO5 — CID 91730274
decyl 2-(2-methoxyethoxycarbonylamino)-3,3-dimethylbutanoate (PubChem CID 91730274) has the molecular formula C20H39NO5 and a molecular weight of 373.53 g/mol. Its IUPAC name is decyl 2-(2-methoxyethoxycarbonylamino)-3,3-dimethylbutanoate.
| Compound Name | decyl 2-(2-methoxyethoxycarbonylamino)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 91730274 |
| Molecular Formula | C20H39NO5 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | decyl 2-(2-methoxyethoxycarbonylamino)-3,3-dimethylbutanoate |
| SMILES | CCCCCCCCCCOC(=O)C(NC(=O)OCCOC)C(C)(C)C |
| InChI | InChI=1S/C20H39NO5/c1-6-7-8-9-10-11-12-13-14-25-18(22)17(20(2,3)4)21-19(23)26-16-15-24-5/h17H,6-16H2,1-5H3,(H,21,23) |
| InChIKey | BSDBUASEOQGANL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|