C12H18Cl6N2O5 — CID 92840466
propyl N-[(1R)-2,2,2-trichloro-1-[(1R)-2,2,2-trichloro-1-(propoxycarbonylamino)ethoxy]ethyl]carbamate (PubChem CID 92840466) has the molecular formula C12H18Cl6N2O5 and a molecular weight of 483.00 g/mol. Its IUPAC name is propyl N-[(1R)-2,2,2-trichloro-1-[(1R)-2,2,2-trichloro-1-(propoxycarbonylamino)ethoxy]ethyl]carbamate.
| Compound Name | propyl N-[(1R)-2,2,2-trichloro-1-[(1R)-2,2,2-trichloro-1-(propoxycarbonylamino)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 92840466 |
| Molecular Formula | C12H18Cl6N2O5 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | propyl N-[(1R)-2,2,2-trichloro-1-[(1R)-2,2,2-trichloro-1-(propoxycarbonylamino)ethoxy]ethyl]carbamate |
| SMILES | CCCOC(=O)NC(O[C@@H](NC(=O)OCCC)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl6N2O5/c1-3-5-23-9(21)19-7(11(13,14)15)25-8(12(16,17)18)20-10(22)24-6-4-2/h7-8H,3-6H2,1-2H3,(H,19,21)(H,20,22)/t7-,8?/m1/s1 |
| InChIKey | HQLKAFIOCDNOON-GVHYBUMESA-N |
| XLogP | 4.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|