C11H11F11O2 — CID 155658052
ethyl 4,5,5,6,6,7,7,7-octafluoro-2-methyl-4-(trifluoromethyl)heptanoate (PubChem CID 155658052) has the molecular formula C11H11F11O2 and a molecular weight of 384.19 g/mol. Its IUPAC name is ethyl 4,5,5,6,6,7,7,7-octafluoro-2-methyl-4-(trifluoromethyl)heptanoate.
| Compound Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-methyl-4-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 155658052 |
| Molecular Formula | C11H11F11O2 |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-methyl-4-(trifluoromethyl)heptanoate |
| SMILES | CCOC(=O)C(C)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F11O2/c1-3-24-6(23)5(2)4-7(12,10(17,18)19)8(13,14)9(15,16)11(20,21)22/h5H,3-4H2,1-2H3 |
| InChIKey | MWYLSBSTGMLLCJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|