C25H52N2O7P+ — CID 174176488
ethyl-[2-[2-[2-ethyl-5-(ethylcarbamoyl)-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium (PubChem CID 174176488) has the molecular formula C25H52N2O7P+ and a molecular weight of 523.67 g/mol. Its IUPAC name is ethyl-[2-[2-[2-ethyl-5-(ethylcarbamoyl)-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium.
| Compound Name | ethyl-[2-[2-[2-ethyl-5-(ethylcarbamoyl)-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 174176488 |
| Molecular Formula | C25H52N2O7P+ |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | ethyl-[2-[2-[2-ethyl-5-(ethylcarbamoyl)-2,3,3,6,6-pentamethylheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium |
| SMILES | CCNC(=O)C(CC(C)(C)C(C)(CC)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)CC)C(C)(C)C |
| InChI | InChI=1S/C25H51N2O7P/c1-12-25(9,24(7,8)19-20(23(4,5)6)21(28)26-13-2)22(29)32-17-18-34-35(30,31)33-16-15-27(10,11)14-3/h20H,12-19H2,1-11H3,(H-,26,28,30,31)/p+1 |
| InChIKey | JNOTTWMMJBFYKG-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|