C32H56N2O11P+ — CID 146899453
2-[2-[4-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]-2-ethyl-2,4,6,6-tetramethyl-7-oxo-7-propoxyheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 146899453) has the molecular formula C32H56N2O11P+ and a molecular weight of 675.78 g/mol. Its IUPAC name is 2-[2-[4-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]-2-ethyl-2,4,6,6-tetramethyl-7-oxo-7-propoxyheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[4-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]-2-ethyl-2,4,6,6-tetramethyl-7-oxo-7-propoxyheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 146899453 |
| Molecular Formula | C32H56N2O11P+ |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 2-[2-[4-[2-(3,4-dihydroxyphenyl)ethylcarbamoyl]-2-ethyl-2,4,6,6-tetramethyl-7-oxo-7-propoxyheptanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCOC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)C)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C32H55N2O11P/c1-10-17-42-28(38)30(3,4)22-32(6,27(37)33-15-14-24-12-13-25(35)26(36)21-24)23-31(5,11-2)29(39)43-19-20-45-46(40,41)44-18-16-34(7,8)9/h12-13,21H,10-11,14-20,22-23H2,1-9H3,(H3-,33,35,36,37,40,41)/p+1 |
| InChIKey | DMCYEISVFTUFOZ-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|