C14H25NO8P+ — CID 130295397
2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-bis(hydroxymethyl)-methylazanium (PubChem CID 130295397) has the molecular formula C14H25NO8P+ and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-bis(hydroxymethyl)-methylazanium.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-bis(hydroxymethyl)-methylazanium |
|---|---|
| PubChem CID | 130295397 |
| Molecular Formula | C14H25NO8P+ |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-bis(hydroxymethyl)-methylazanium |
| SMILES | C[N+](CO)(CO)CCOP(=O)(O)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H24NO8P/c1-15(10-16,11-17)6-8-23-24(20,21)22-7-2-3-12-4-5-13(18)14(19)9-12/h4-5,9,16-17H,2-3,6-8,10-11H2,1H3,(H2-,18,19,20,21)/p+1 |
| InChIKey | OHEUCSJQWYNOJC-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|