C18H34N2O6P+ — CID 170121017
(1-amino-3-methylbutyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium (PubChem CID 170121017) has the molecular formula C18H34N2O6P+ and a molecular weight of 405.45 g/mol. Its IUPAC name is (1-amino-3-methylbutyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium.
| Compound Name | (1-amino-3-methylbutyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 170121017 |
| Molecular Formula | C18H34N2O6P+ |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (1-amino-3-methylbutyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]-dimethylazanium |
| SMILES | CC(C)CC(N)[N+](C)(C)CCOP(=O)(O)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H33N2O6P/c1-14(2)12-18(19)20(3,4)9-11-26-27(23,24)25-10-5-6-15-7-8-16(21)17(22)13-15/h7-8,13-14,18H,5-6,9-12,19H2,1-4H3,(H2-,21,22,23,24)/p+1 |
| InChIKey | BHNZQEKOIWMJBP-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|