C18H33NO6P+ — CID 145286118
butyl-[2-[3-(3,4-dihydroxyphenyl)propoxy-methoxyphosphoryl]oxyethyl]-dimethylazanium (PubChem CID 145286118) has the molecular formula C18H33NO6P+ and a molecular weight of 390.44 g/mol. Its IUPAC name is butyl-[2-[3-(3,4-dihydroxyphenyl)propoxy-methoxyphosphoryl]oxyethyl]-dimethylazanium.
| Compound Name | butyl-[2-[3-(3,4-dihydroxyphenyl)propoxy-methoxyphosphoryl]oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 145286118 |
| Molecular Formula | C18H33NO6P+ |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | butyl-[2-[3-(3,4-dihydroxyphenyl)propoxy-methoxyphosphoryl]oxyethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCOP(=O)(OC)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H32NO6P/c1-5-6-11-19(2,3)12-14-25-26(22,23-4)24-13-7-8-16-9-10-17(20)18(21)15-16/h9-10,15H,5-8,11-14H2,1-4H3,(H-,20,21)/p+1 |
| InChIKey | AVGLRHAWKPWLIF-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|