C14H28N4O6P+ — CID 130294920
tris(aminomethyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]azanium (PubChem CID 130294920) has the molecular formula C14H28N4O6P+ and a molecular weight of 379.37 g/mol. Its IUPAC name is tris(aminomethyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]azanium.
| Compound Name | tris(aminomethyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]azanium |
|---|---|
| PubChem CID | 130294920 |
| Molecular Formula | C14H28N4O6P+ |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tris(aminomethyl)-[2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl]azanium |
| SMILES | NC[N+](CN)(CN)CCOP(=O)(O)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H27N4O6P/c15-9-18(10-16,11-17)5-7-24-25(21,22)23-6-1-2-12-3-4-13(19)14(20)8-12/h3-4,8H,1-2,5-7,9-11,15-17H2,(H2-,19,20,21,22)/p+1 |
| InChIKey | DGRUVSKGYSNRBM-UHFFFAOYSA-O |
| XLogP | -0.27 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|