C14H25NO6PS3+ — CID 130295399
2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-tris(sulfanylmethyl)azanium (PubChem CID 130295399) has the molecular formula C14H25NO6PS3+ and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-tris(sulfanylmethyl)azanium.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-tris(sulfanylmethyl)azanium |
|---|---|
| PubChem CID | 130295399 |
| Molecular Formula | C14H25NO6PS3+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-tris(sulfanylmethyl)azanium |
| SMILES | O=P(O)(OCCCc1ccc(O)c(O)c1)OCC[N+](CS)(CS)CS |
| InChI | InChI=1S/C14H24NO6PS3/c16-13-4-3-12(8-14(13)17)2-1-6-20-22(18,19)21-7-5-15(9-23,10-24)11-25/h3-4,8H,1-2,5-7,9-11H2,(H5-,16,17,18,19,23,24,25)/p+1 |
| InChIKey | KJOFKMSQVIWEKW-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|