C15H27NO6P+ — CID 140801229
2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-ethyl-dimethylazanium (PubChem CID 140801229) has the molecular formula C15H27NO6P+ and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-ethyl-dimethylazanium.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 140801229 |
| Molecular Formula | C15H27NO6P+ |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)propoxy-hydroxyphosphoryl]oxyethyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCOP(=O)(O)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H26NO6P/c1-4-16(2,3)9-11-22-23(19,20)21-10-5-6-13-7-8-14(17)15(18)12-13/h7-8,12H,4-6,9-11H2,1-3H3,(H2-,17,18,19,20)/p+1 |
| InChIKey | CHQULEUNJZRDSS-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|