C15H20O7 — CID 159921575
2-[2-[5-(3,4-dihydroxyphenyl)-2-oxopentoxy]ethoxy]acetic acid (PubChem CID 159921575) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-[2-[5-(3,4-dihydroxyphenyl)-2-oxopentoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-(3,4-dihydroxyphenyl)-2-oxopentoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 159921575 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[2-[5-(3,4-dihydroxyphenyl)-2-oxopentoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCC(=O)CCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H20O7/c16-12(9-21-6-7-22-10-15(19)20)3-1-2-11-4-5-13(17)14(18)8-11/h4-5,8,17-18H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | NYLSPFKYSLCPJM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|