C18H28O3 — CID 126752163
5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one (PubChem CID 126752163) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one.
| Compound Name | 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one |
|---|---|
| PubChem CID | 126752163 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one |
| SMILES | CCCOCCOCC(=O)CCCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H28O3/c1-4-10-20-11-12-21-14-18(19)7-5-6-17-9-8-15(2)16(3)13-17/h8-9,13H,4-7,10-12,14H2,1-3H3 |
| InChIKey | IVKQDXLIZHJLTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|