About 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one
5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one (PubChem CID 126752163) has the molecular formula C18H28O3
and a molecular weight of 292.40 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one.
Molecular Properties
| Compound Name | 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one |
| PubChem CID | 126752163 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one |
| SMILES | CCCOCCOCC(=O)CCCC1=CC(=C(C=C1)C)C |
| InChI | InChI=1S/C18H28O3/c1-4-10-20-11-12-21-14-18(19)7-5-6-17-9-8-15(2)16(3)13-17/h8-9,13H,4-7,10-12,14H2,1-3H3 |
| InChIKey | IVKQDXLIZHJLTP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | 278 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one?
The IUPAC name of 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one (CID 126752163) is 5-(3,4-dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one.
What is the SMILES notation for 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one?
The canonical SMILES for 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one is CCCOCCOCC(=O)CCCC1=CC(=C(C=C1)C)C.
What is the InChIKey of 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one?
The InChIKey is IVKQDXLIZHJLTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-4-10-20-11-12-21-14-18(19)7-5-6-17-9-8-15(2)16(3)13-17/h8-9,13H,4-7,10-12,14H2,1-3H3.
What are the key properties of 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one?
5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one has a molecular weight of 292.40 g/mol, XLogP of 3.60, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-Dimethylphenyl)-1-(2-propoxyethoxy)pentan-2-one is sourced from PubChem (CID 126752163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).