C23H26O5 — CID 58348906
[2-acetyloxy-4-[5-(3,4-dimethylphenyl)-4-oxopentyl]phenyl] acetate (PubChem CID 58348906) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-acetyloxy-4-[5-(3,4-dimethylphenyl)-4-oxopentyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[5-(3,4-dimethylphenyl)-4-oxopentyl]phenyl] acetate |
|---|---|
| PubChem CID | 58348906 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [2-acetyloxy-4-[5-(3,4-dimethylphenyl)-4-oxopentyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CCCC(=O)Cc2ccc(C)c(C)c2)cc1OC(C)=O |
| InChI | InChI=1S/C23H26O5/c1-15-8-9-20(12-16(15)2)13-21(26)7-5-6-19-10-11-22(27-17(3)24)23(14-19)28-18(4)25/h8-12,14H,5-7,13H2,1-4H3 |
| InChIKey | VKLLUULLQWNGCR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|