C13H15NO5 — CID 139641556
[2-acetyloxy-4-[2-(methylamino)-2-oxoethyl]phenyl] acetate (PubChem CID 139641556) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is [2-acetyloxy-4-[2-(methylamino)-2-oxoethyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[2-(methylamino)-2-oxoethyl]phenyl] acetate |
|---|---|
| PubChem CID | 139641556 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [2-acetyloxy-4-[2-(methylamino)-2-oxoethyl]phenyl] acetate |
| SMILES | CNC(=O)Cc1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C13H15NO5/c1-8(15)18-11-5-4-10(7-13(17)14-3)6-12(11)19-9(2)16/h4-6H,7H2,1-3H3,(H,14,17) |
| InChIKey | GETJEOUMLYPSOF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|