C36H39O12Se+ — CID 71489018
tris[2-(3,4-diacetyloxyphenyl)ethyl]selanium (PubChem CID 71489018) has the molecular formula C36H39O12Se+ and a molecular weight of 742.66 g/mol. Its IUPAC name is tris[2-(3,4-diacetyloxyphenyl)ethyl]selanium.
| Compound Name | tris[2-(3,4-diacetyloxyphenyl)ethyl]selanium |
|---|---|
| PubChem CID | 71489018 |
| Molecular Formula | C36H39O12Se+ |
| Molecular Weight | 742.66 g/mol |
| Exact Mass | 743.16 |
| IUPAC Name | tris[2-(3,4-diacetyloxyphenyl)ethyl]selanium |
| SMILES | CC(=O)Oc1ccc(CC[Se+](CCc2ccc(OC(C)=O)c(OC(C)=O)c2)CCc2ccc(OC(C)=O)c(OC(C)=O)c2)cc1OC(C)=O |
| InChI | InChI=1S/C36H39O12Se/c1-22(37)43-31-10-7-28(19-34(31)46-25(4)40)13-16-49(17-14-29-8-11-32(44-23(2)38)35(20-29)47-26(5)41)18-15-30-9-12-33(45-24(3)39)36(21-30)48-27(6)42/h7-12,19-21H,13-18H2,1-6H3/q+1 |
| InChIKey | YYHBAJWFJZQEMB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|