C19H20O5 — CID 141220884
[2-acetyloxy-4-[(2,6-dimethylphenoxy)methyl]phenyl] acetate (PubChem CID 141220884) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [2-acetyloxy-4-[(2,6-dimethylphenoxy)methyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(2,6-dimethylphenoxy)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 141220884 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-acetyloxy-4-[(2,6-dimethylphenoxy)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COc2c(C)cccc2C)cc1OC(C)=O |
| InChI | InChI=1S/C19H20O5/c1-12-6-5-7-13(2)19(12)22-11-16-8-9-17(23-14(3)20)18(10-16)24-15(4)21/h5-10H,11H2,1-4H3 |
| InChIKey | HYGYGDZPXAAOBR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|