C24H24O4 — CID 87367032
benzene;[3-[(2,6-dimethylphenoxy)methyl]-4-formylphenyl] acetate (PubChem CID 87367032) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is benzene;[3-[(2,6-dimethylphenoxy)methyl]-4-formylphenyl] acetate.
| Compound Name | benzene;[3-[(2,6-dimethylphenoxy)methyl]-4-formylphenyl] acetate |
|---|---|
| PubChem CID | 87367032 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | benzene;[3-[(2,6-dimethylphenoxy)methyl]-4-formylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=O)c(COc2c(C)cccc2C)c1.c1ccccc1 |
| InChI | InChI=1S/C18H18O4.C6H6/c1-12-5-4-6-13(2)18(12)21-11-16-9-17(22-14(3)20)8-7-15(16)10-19;1-2-4-6-5-3-1/h4-10H,11H2,1-3H3;1-6H |
| InChIKey | DSIGUCIFCSYWSV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|