About acetic acid;(4-formyl-3-hydroxyphenyl) acetate
acetic acid;(4-formyl-3-hydroxyphenyl) acetate (PubChem CID 87581863) has the molecular formula C11H12O6
and a molecular weight of 240.21 g/mol. Its IUPAC name is acetic acid;(4-formyl-3-hydroxyphenyl) acetate.
Molecular Properties
| Compound Name | acetic acid;(4-formyl-3-hydroxyphenyl) acetate |
| PubChem CID | 87581863 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | acetic acid;(4-formyl-3-hydroxyphenyl) acetate |
| SMILES | CC(=O)O.CC(=O)Oc1ccc(C=O)c(O)c1 |
| InChI | InChI=1S/C9H8O4.C2H4O2/c1-6(11)13-8-3-2-7(5-10)9(12)4-8;1-2(3)4/h2-5,12H,1H3;1H3,(H,3,4) |
| InChIKey | HZLMOTIHLJZUEL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(4-formyl-3-hydroxyphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(4-formyl-3-hydroxyphenyl) acetate?
The IUPAC name of acetic acid;(4-formyl-3-hydroxyphenyl) acetate (CID 87581863) is acetic acid;(4-formyl-3-hydroxyphenyl) acetate.
What is the SMILES notation for acetic acid;(4-formyl-3-hydroxyphenyl) acetate?
The canonical SMILES for acetic acid;(4-formyl-3-hydroxyphenyl) acetate is CC(=O)O.CC(=O)Oc1ccc(C=O)c(O)c1.
What is the InChIKey of acetic acid;(4-formyl-3-hydroxyphenyl) acetate?
The InChIKey is HZLMOTIHLJZUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C2H4O2/c1-6(11)13-8-3-2-7(5-10)9(12)4-8;1-2(3)4/h2-5,12H,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;(4-formyl-3-hydroxyphenyl) acetate?
acetic acid;(4-formyl-3-hydroxyphenyl) acetate has a molecular weight of 240.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(4-formyl-3-hydroxyphenyl) acetate is sourced from PubChem (CID 87581863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).