About (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate
(4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate (PubChem CID 71420117) has the molecular formula C19H20O5
and a molecular weight of 328.36 g/mol. Its IUPAC name is (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate.
Molecular Properties
| Compound Name | (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate |
| PubChem CID | 71420117 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C=O)c(O)c2)cc1 |
| InChI | InChI=1S/C19H20O5/c1-2-3-4-11-23-16-8-5-14(6-9-16)19(22)24-17-10-7-15(13-20)18(21)12-17/h5-10,12-13,21H,2-4,11H2,1H3 |
| InChIKey | INWRBOXSCRCMEB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate?
The IUPAC name of (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate (CID 71420117) is (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate.
What is the SMILES notation for (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate?
The canonical SMILES for (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(C=O)c(O)c2)cc1.
What is the InChIKey of (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate?
The InChIKey is INWRBOXSCRCMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O5/c1-2-3-4-11-23-16-8-5-14(6-9-16)19(22)24-17-10-7-15(13-20)18(21)12-17/h5-10,12-13,21H,2-4,11H2,1H3.
What are the key properties of (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate?
(4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate has a molecular weight of 328.36 g/mol, XLogP of 3.99, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-3-hydroxyphenyl) 4-pentoxybenzoate is sourced from PubChem (CID 71420117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).