C36H46O8 — CID 157129193
(4-formyl-3-methoxyphenyl) 4-heptoxybenzoate;4-heptoxybenzoic acid (PubChem CID 157129193) has the molecular formula C36H46O8 and a molecular weight of 606.76 g/mol. Its IUPAC name is (4-formyl-3-methoxyphenyl) 4-heptoxybenzoate;4-heptoxybenzoic acid.
| Compound Name | (4-formyl-3-methoxyphenyl) 4-heptoxybenzoate;4-heptoxybenzoic acid |
|---|---|
| PubChem CID | 157129193 |
| Molecular Formula | C36H46O8 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | (4-formyl-3-methoxyphenyl) 4-heptoxybenzoate;4-heptoxybenzoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)O)cc1.CCCCCCCOc1ccc(C(=O)Oc2ccc(C=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H26O5.C14H20O3/c1-3-4-5-6-7-14-26-19-11-8-17(9-12-19)22(24)27-20-13-10-18(16-23)21(15-20)25-2;1-2-3-4-5-6-11-17-13-9-7-12(8-10-13)14(15)16/h8-13,15-16H,3-7,14H2,1-2H3;7-10H,2-6,11H2,1H3,(H,15,16) |
| InChIKey | AIVYDWZFTNOKNK-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|