C20H25NO3Si — CID 123386972
1-[2-[(2,6-dimethylphenoxy)methyl]-4-trimethylsilyloxyphenyl]-2-iminoethanone (PubChem CID 123386972) has the molecular formula C20H25NO3Si and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-[2-[(2,6-dimethylphenoxy)methyl]-4-trimethylsilyloxyphenyl]-2-iminoethanone.
| Compound Name | 1-[2-[(2,6-dimethylphenoxy)methyl]-4-trimethylsilyloxyphenyl]-2-iminoethanone |
|---|---|
| PubChem CID | 123386972 |
| Molecular Formula | C20H25NO3Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[2-[(2,6-dimethylphenoxy)methyl]-4-trimethylsilyloxyphenyl]-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)c1ccc(O[Si](C)(C)C)cc1COc1c(C)cccc1C |
| InChI | InChI=1S/C20H25NO3Si/c1-14-7-6-8-15(2)20(14)23-13-16-11-17(24-25(3,4)5)9-10-18(16)19(22)12-21/h6-12,21H,13H2,1-5H3/b21-12+ |
| InChIKey | FHQSLZVSWDLZMO-CIAFOILYSA-N |
| XLogP | 4.93 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|