C21H26O6Si — CID 174607269
2-[(2,6-dimethylphenoxy)methyl]-4-methyl-6-trimethylsilyloxybenzene-1,3-dicarboxylic acid (PubChem CID 174607269) has the molecular formula C21H26O6Si and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenoxy)methyl]-4-methyl-6-trimethylsilyloxybenzene-1,3-dicarboxylic acid.
| Compound Name | 2-[(2,6-dimethylphenoxy)methyl]-4-methyl-6-trimethylsilyloxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174607269 |
| Molecular Formula | C21H26O6Si |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[(2,6-dimethylphenoxy)methyl]-4-methyl-6-trimethylsilyloxybenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cccc(C)c1OCc1c(C(=O)O)c(C)cc(O[Si](C)(C)C)c1C(=O)O |
| InChI | InChI=1S/C21H26O6Si/c1-12-8-7-9-13(2)19(12)26-11-15-17(20(22)23)14(3)10-16(18(15)21(24)25)27-28(4,5)6/h7-10H,11H2,1-6H3,(H,22,23)(H,24,25) |
| InChIKey | NMBSEKFKJMGSHF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|