C18H19NO2 — CID 123634687
2-imino-1-[2-[(3,4,5-trimethylphenoxy)methyl]phenyl]ethanone (PubChem CID 123634687) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-imino-1-[2-[(3,4,5-trimethylphenoxy)methyl]phenyl]ethanone.
| Compound Name | 2-imino-1-[2-[(3,4,5-trimethylphenoxy)methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 123634687 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-imino-1-[2-[(3,4,5-trimethylphenoxy)methyl]phenyl]ethanone |
| SMILES | [H]/N=C/C(=O)c1ccccc1COc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C18H19NO2/c1-12-8-16(9-13(2)14(12)3)21-11-15-6-4-5-7-17(15)18(20)10-19/h4-10,19H,11H2,1-3H3/b19-10+ |
| InChIKey | QASMQYGQOATTFJ-VXLYETTFSA-N |
| XLogP | 4.02 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|