C23H31NO3Si — CID 87211646
2-[2-[(2,6-dimethylphenoxy)methyl]-4-triethylsilyloxyphenyl]-2-hydroxyacetonitrile (PubChem CID 87211646) has the molecular formula C23H31NO3Si and a molecular weight of 397.59 g/mol. Its IUPAC name is 2-[2-[(2,6-dimethylphenoxy)methyl]-4-triethylsilyloxyphenyl]-2-hydroxyacetonitrile.
| Compound Name | 2-[2-[(2,6-dimethylphenoxy)methyl]-4-triethylsilyloxyphenyl]-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 87211646 |
| Molecular Formula | C23H31NO3Si |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[2-[(2,6-dimethylphenoxy)methyl]-4-triethylsilyloxyphenyl]-2-hydroxyacetonitrile |
| SMILES | CC[Si](CC)(CC)Oc1ccc(C(O)C#N)c(COc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C23H31NO3Si/c1-6-28(7-2,8-3)27-20-12-13-21(22(25)15-24)19(14-20)16-26-23-17(4)10-9-11-18(23)5/h9-14,22,25H,6-8,16H2,1-5H3 |
| InChIKey | SCAGBQUYHBKUFO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|