C11H14O4S — CID 163273899
2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid (PubChem CID 163273899) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 163273899 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H14O4S/c12-9-4-3-8(6-10(9)13)2-1-5-16-7-11(14)15/h3-4,6,12-13H,1-2,5,7H2,(H,14,15) |
| InChIKey | DGCGBUBHWWNZFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|