2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid

C11H14O4S — CID 163273899

IUPAC2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid
SMILESO=C(O)CSCCCc1ccc(O)c(O)c1
InChIInChI=1S/C11H14O4S/c12-9-4-3-8(6-10(9)13)2-1-5-16-7-11(14)15/h3-4,6,12-13H,1-2,5,7H2,(H,14,15)
InChIKeyDGCGBUBHWWNZFI-UHFFFAOYSA-N
MW242.30 g/mol
LogP1.85
Rot. Bonds6

About 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid

2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid (PubChem CID 163273899) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid.

Molecular Properties

Compound Name2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid
PubChem CID163273899
Molecular FormulaC11H14O4S
Molecular Weight242.30 g/mol
Exact Mass242.06
IUPAC Name2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid
SMILESO=C(O)CSCCCc1ccc(O)c(O)c1
InChIInChI=1S/C11H14O4S/c12-9-4-3-8(6-10(9)13)2-1-5-16-7-11(14)15/h3-4,6,12-13H,1-2,5,7H2,(H,14,15)
InChIKeyDGCGBUBHWWNZFI-UHFFFAOYSA-N
XLogP1.85
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.30
LogP ≤ 51.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid?
The IUPAC name of 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid (CID 163273899) is 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid.
What is the SMILES notation for 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid?
The canonical SMILES for 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid is O=C(O)CSCCCc1ccc(O)c(O)c1.
What is the InChIKey of 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid?
The InChIKey is DGCGBUBHWWNZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c12-9-4-3-8(6-10(9)13)2-1-5-16-7-11(14)15/h3-4,6,12-13H,1-2,5,7H2,(H,14,15).
What are the key properties of 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid?
2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid has a molecular weight of 242.30 g/mol, XLogP of 1.85, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dihydroxyphenyl)propylsulfanyl]acetic acid is sourced from PubChem (CID 163273899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).