C12H14O6S — CID 176803074
2-[3-(3,4-dihydroxybenzoyl)oxypropylsulfanyl]acetic acid (PubChem CID 176803074) has the molecular formula C12H14O6S and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxybenzoyl)oxypropylsulfanyl]acetic acid.
| Compound Name | 2-[3-(3,4-dihydroxybenzoyl)oxypropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 176803074 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[3-(3,4-dihydroxybenzoyl)oxypropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCOC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H14O6S/c13-9-3-2-8(6-10(9)14)12(17)18-4-1-5-19-7-11(15)16/h2-3,6,13-14H,1,4-5,7H2,(H,15,16) |
| InChIKey | BHRNCGSNFZRLGO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|