C15H20O4S — CID 175435371
ethyl 3-[3-(3,4-dihydroxyphenyl)propylsulfanyl]-2-methylprop-2-enoate (PubChem CID 175435371) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is ethyl 3-[3-(3,4-dihydroxyphenyl)propylsulfanyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[3-(3,4-dihydroxyphenyl)propylsulfanyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175435371 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | ethyl 3-[3-(3,4-dihydroxyphenyl)propylsulfanyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=CSCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H20O4S/c1-3-19-15(18)11(2)10-20-8-4-5-12-6-7-13(16)14(17)9-12/h6-7,9-10,16-17H,3-5,8H2,1-2H3 |
| InChIKey | BGKOTYYRSHYRIF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|